| Identification | Back Directory | [Name]
6-Oxa-2-azaspiro[3.4]octane oxalate (2:1) | [CAS]
1523571-05-2 | [Synonyms]
6-oxa-2-azaspiro[3.4]octane hemi(oxalic acid) | [Molecular Formula]
C14H24N2O6 | [MDL Number]
MFCD27988098 | [MOL File]
1523571-05-2.mol | [Molecular Weight]
316.35 |
| Chemical Properties | Back Directory | [storage temp. ]
Inert atmosphere,2-8°C | [InChI]
InChI=1S/2C6H11NO.C2H2O4/c2*1-2-8-5-6(1)3-7-4-6;3-1(4)2(5)6/h2*7H,1-5H2;(H,3,4)(H,5,6) | [InChIKey]
DXQBWHZOWKIQGE-UHFFFAOYSA-N | [SMILES]
OC(C(=O)O)=O.C1C2(COCC2)CN1.C1C2(COCC2)CN1 |
| Hazard Information | Back Directory | [Uses]
6-Oxa-2-azaspiro[3.4]octane Hemioxalate is the hemioxalate salt of 6-Oxa-2-azaspiro[3.4]octane. 6-Oxa-2-azaspiro[3.4]octane is used as a reactant in the preparation of aminopyridine derivatives as PI3K inhibitors. |
|
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
BePharm Ltd
|
| Tel: |
400-685-9117 |
| Website: |
www.bepharm.com |
|