| Identification | Back Directory | [Name]
NI(II)-1,4,8,11,15,18,22,25-OCTABUTOXY- PHTHALOCYANINE | [CAS]
155773-71-0 | [Synonyms]
nickel (ii) 1,4,8,11,14,18,22,25-octa-*N-butoxy-2 NICKEL (II) 1,4,8,11,14,18,22,25-OCTA-*N -BUTOXY-29H NI(II)-1,4,8,11,15,18,22,25-OCTABUTOXY- PHTHALOCYANINE Nickel(II)-1,4,8,11,15,18,22,25-octabutoxyphthalocyanine Nickel(II) 1,4,8,11,15,18,22,25-octabutoxy-29H,31H-phthalocyanine Nickel(II) 1,4,8,11,15,18,22,25-octabutoxy-29H,31H-phthalocyanine Dye content Nickel(II) 1,4,8,11,15,18,22,25-octabutoxy-29H,31H-phthalocyanine Dye content 97 % | [Molecular Formula]
C64H80N8NiO8 | [MDL Number]
MFCD00192346 | [MOL File]
155773-71-0.mol | [Molecular Weight]
1148.08 |
| Chemical Properties | Back Directory | [Melting point ]
288-293 °C(lit.) | [λmax]
743 nm | [InChIKey]
JFVRZEMMDHQJPH-UHFFFAOYSA-N | [SMILES]
CCCCOc1ccc(OCCCC)c2c3nc(nc4n5[Ni]n6c(n3)c7c(OCCCC)ccc(OCCCC)c7c6nc8nc(nc5c9c(OCCCC)ccc(OCCCC)c49)c%10c(OCCCC)ccc(OCCCC)c8%10)c12 |
| Safety Data | Back Directory | [Hazard Codes ]
T | [Risk Statements ]
49-43 | [Safety Statements ]
53-36/37/39-45 | [WGK Germany ]
3 | [Storage Class]
6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | [Hazard Classifications]
Skin Sens. 1 |
| Questions And Answer | Back Directory | [Application]
Octabutoxy phthalocyanine nickel is a nickel(II) phthalocyanine dye with good optical properties and biocompatibility, and can be used in fields such as biomedical imaging, photodynamic therapy and fluorescent labeling. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
+1 (201) 478-8534 |
| Website: |
www.alfa-chemistry.com |
| Company Name: |
Reagent World
|
| Tel: |
+1 (909) 947-7779 |
| Website: |
www.reagentworld.com |
| Company Name: |
Panslavia Chemicals, LLC
|
| Tel: |
+1 (414) 393-1901 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList13962/0_EN.htm |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|