| Identification | Back Directory | [Name]
1,2,4-butanetriol-3-(1,4,7,10-tetraazacyclododec-1-yl)4hydrochloride | [CAS]
156077-56-4 | [Synonyms]
3-(1,4,7,10-tetraazacyclododecan-1-yl)butan-1,2,4-triol HC
3-(1,4,7,10-tetraazacyclododecan-1-yl)butan-1,2,4-triol HCl
3-(1,4,7,10-tetraazacyclododecan-1-yl)butan-1,2,4-triol 4HCl
1,2,4-butanetriol-3-(1,4,7,10-tetraazacyclododec-1-yl)4hydro...
1,2,4-butanetriol-3-(1,4,7,10-tetraazacyclododec-1-yl)4hydrochloride
3-(1,4,7,10-Tetraazacyclododec-1-yl)-1,2,4-butanetriol hydrochloride (1:4) | [Molecular Formula]
C12H29ClN4O3 | [MDL Number]
MFCD32898412 | [MOL File]
156077-56-4.mol | [Molecular Weight]
312.84 |
| Chemical Properties | Back Directory | [InChI]
InChI=1S/C12H28N4O3.ClH/c17-9-11(12(19)10-18)16-7-5-14-3-1-13-2-4-15-6-8-16;/h11-15,17-19H,1-10H2;1H | [InChIKey]
UALUBNYCZRCXAF-UHFFFAOYSA-N | [SMILES]
C(N1CCNCCNCCNCC1)(CO)C(O)CO.Cl |
| Hazard Information | Back Directory | [Uses]
1,2,4-butanetriol-3-(1,4,7,10-tetraazacyclododec-1-yl)4hydrochloride is an intermediate that manufacture gadobutrol . gadobutrol is a gadolinium-based contrast agent indicated for intravenous use in diagnostic MRI in adults and children (2 years of age and older) to detect and visualize areas with disrupted blood brain barrier (BBB) and/or abnormal vascularity of the central nervous system. |
|
| Company Name: |
Chem-Stone Co.,Ltd. Gold
|
| Telephone: |
020-82185713,82185709 13418171485 |
| Website: |
www.chem-stone.com |
| Company Name: |
Sinfachem Limited.
|
| Telephone: |
025-84683399 13952017251 |
| Website: |
http://www.sinfachem.com |
| Company Name: |
yxinchem
|
| Telephone: |
+86-0710-4323688 +86-18071785587 |
| Website: |
http://www.yxinchem.com |
| Company Name: |
Shanghai UCHEM Inc.
|
| Telephone: |
+86-18930848214 +86-021-56762820 |
| Website: |
http://www.myuchem.com/ |
| Company Name: |
Fuxin Pharmaceutical
|
| Telephone: |
021-50872116 13391048226 |
| Website: |
https://www.fuxinpharm.com |
|