| Identification | Back Directory | [Name]
4-Isopropylcyclohexanol | [CAS]
15890-36-5 | [Synonyms]
Ccris 8052 trans-4-Isopropylcyclohexanol trans-4-Isopropylcyclohexanol> trans-4-(1-Methylethyl)cyclohexanol trans-4-Isopropylcyclohexanol Cyclohexanol, 4-(1-methylethyl)-, trans- | [Molecular Formula]
C9H18O | [MOL File]
15890-36-5.mol | [Molecular Weight]
142.24 |
| Chemical Properties | Back Directory | [Melting point ]
6°C(lit.) | [Boiling point ]
94°C/5mmHg(lit.) | [density ]
0.9150 | [refractive index ]
1.4640 to 1.4680 | [form ]
clear liquid | [pka]
15.30±0.40(Predicted) | [color ]
Colorless to Almost colorless | [InChI]
InChI=1S/C9H18O/c1-7(2)8-3-5-9(10)6-4-8/h7-10H,3-6H2,1-2H3/t8-,9- | [InChIKey]
DKKRDMLKVSKFMJ-KYZUINATSA-N | [SMILES]
[C@@H]1(O)CC[C@@H](C(C)C)CC1 | [CAS DataBase Reference]
15890-36-5 |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
|