| Identification | Back Directory | [Name]
4',4'',4''',4''''-(ethene-1,1,2,2-tetrayl)tetrabiphenyl-4-carboxylic acid | [CAS]
1610858-96-2 | [Synonyms]
JACS-1610858-96-2
1,1,2,2-Tetra(4-carboxylbiphenyl)ethylene
4',4'',4''',4''''-(ethene-1,1,2,2-tetrayl)tetrabiphenyl-4-carboxylic acid
4'-[1,2,2-Tris(4'-carboxy[1,1'-biphenyl]-4-yl)ethenyl][1,1'-biphenyl]-4-carboxylic acid
[1,1'-Biphenyl]-4-carboxylic acid, 4'-[1,2,2-tris(4'-carboxy[1,1'-biphenyl]-4-yl)ethenyl]-
4',4''',4''''',4'''''''-(ethene-1,1,2,2-tetrayl)tetrakis(([1,1'-biphenyl]-4-carboxylic acid)) | [Molecular Formula]
C54H36O8 | [MDL Number]
MFCD30537426 | [MOL File]
1610858-96-2.mol | [Molecular Weight]
812.86 |
| Chemical Properties | Back Directory | [Boiling point ]
987.7±65.0 °C(Predicted) | [density ]
1.317±0.06 g/cm3(Predicted) | [storage temp. ]
Storage temp. 2-8°C | [pka]
3.59±0.10(Predicted) | [Appearance]
Light yellow to green yellow Solid | [InChIKey]
IIIWRSPHUBZZOB-UHFFFAOYSA-N | [SMILES]
C(/C1=CC=C(C2=CC=C(C(O)=O)C=C2)C=C1)(\C1=CC=C(C2=CC=C(C(O)=O)C=C2)C=C1)=C(\C1=CC=C(C2=CC=C(C(O)=O)C=C2)C=C1)/C1=CC=C(C2=CC=C(C(O)=O)C=C2)C=C1 |
| Hazard Information | Back Directory | [Description]
4',4'',4''',4''''-(ethene-1,1,2,2-tetrayl)tetrabiphenyl-4-carboxylic acid (H4ETTC) is a chelating ligand, it can
coordinate with metal ions through carboxylic acid and sulfur atoms to
form stable complexes with metal ions. | [Uses]
Used as ligands in the synthesis of MOF materials: PCN-94; PCN-128; LMOF-231; Zr/HfTCPE. |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Feihe Pharmatech Co.,Ltd
|
| Telephone: |
021-33926058 18030239092 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList19123/0_EN.htm |
|