| Identification | Back Directory | [Name]
L-ALANINE-3,3,3-D3-N-T-BOC | [CAS]
161602-47-7 | [Synonyms]
N-Boc-L-Alanine-D3 boc-ala-oh-3,3,3-d3 L-ALANINE-3,3,3-D3-N-T-BOC Boc-L-<3',3',3'-2H3>alanine L-ALANINE-N-T-BOC (3,3,3-D3) L-Alanine-3,3,3-d3, N-t-Boc derivative N-(TERT-BUTOXYCARBONYL)-L-ALANINE-3,3,3-D3 N-(TERT-BUTOXYCARBONYL)-L-ALANINE--3,3,3 ,-D3, 99 ATOM % D N-(tert-Butoxycarbonyl)-L-alanine-3,3,3-d3, L-Alanine-3,3,3-d3, N-t-Boc derivative | [Molecular Formula]
C8H12D3NO4 | [MDL Number]
MFCD00084110 | [MOL File]
161602-47-7.mol | [Molecular Weight]
192.23 |
| Chemical Properties | Back Directory | [Melting point ]
79-83 °C(lit.) | [form ]
solid | [Optical Rotation]
[α]20/D 23°, c = 2 in acetic acid | [Major Application]
peptide synthesis | [InChI]
1S/C8H15NO4/c1-5(6(10)11)9-7(12)13-8(2,3)4/h5H,1-4H3,(H,9,12)(H,10,11)/t5-/m0/s1/i1D3 | [InChIKey]
QVHJQCGUWFKTSE-MQBGRFPLSA-N | [SMILES]
[2H]C([2H])([2H])[C@H](NC(=O)OC(C)(C)C)C(O)=O | [CAS Number Unlabeled]
15761-38-3 |
| Hazard Information | Back Directory | [Uses]
L-Alanine-3,3,3-d3-N-t-BOC acts as a reagent for the synthesis of amino acid derivatives that serves as precausors for peptides synthesis. |
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|