| Identification | Back Directory | [Name]
9-mesityl-2,7-dimethyl-10-phenylacridin-10-ium tetrafluoroborate | [CAS]
1621020-00-5 | [Synonyms]
-2,7-dimethyL 9-mesityl-2,7-dimethyl-10-phenylacridin-10-ium tetrafluoroborate | [Molecular Formula]
C30H28BF4N | [MDL Number]
MFCD28411689 | [MOL File]
1621020-00-5.mol | [Molecular Weight]
489.355 |
| Chemical Properties | Back Directory | [storage temp. ]
under inert gas (nitrogen or Argon) at 2-8°C | [form ]
solid | [Appearance]
Light yellow to brown Solid | [InChI]
InChI=1S/C30H28N.BF4/c1-19-11-13-27-25(17-19)30(29-22(4)15-21(3)16-23(29)5)26-18-20(2)12-14-28(26)31(27)24-9-7-6-8-10-24;2-1(3,4)5/h6-18H,1-5H3;/q+1;-1 | [InChIKey]
SBPUTXHOHXQDIT-UHFFFAOYSA-N | [SMILES]
C1=C2C([N+](C3=CC=CC=C3)=C3C(=C2C2=C(C)C=C(C)C=C2C)C=C(C)C=C3)=CC=C1C.[B-](F)(F)(F)F |
| Hazard Information | Back Directory | [Uses]
2,7-Dimethyl-9-mesityl-10-phenylacridinium Tetrafluoroborate can be used to synthesize?various bioactive compounds via?site-selective arene amination when used with?an acridinium photooxidant and a nitroxyl radical.?It can also be used to construct γ-lactams and pyrrolidines. | [reaction suitability]
core: acridinium reagent type: catalyst reaction type: Photocatalysis |
|
| Company Name: |
Energy Chemical Gold
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
|