| Identification | Back Directory | [Name]
idoxuridine | [CAS]
162239-35-2 | [Synonyms]
ent-Idoxuridine
Idoxuridine Enantiomer
Idoxuridine Impurity 1
2'-Deoxy-L-5-iodouridine
5-Iodo-2'-deoxy-L-uridine
1-(2-Deoxy-β-L-erythro-pentofuranosyl)-5-iodo-2,4(1H,3H)-pyriMidinedione
2,4(1H,3H)-Pyrimidinedione, 1-(2-deoxy-β-L-erythro-pentofuranosyl)-5-iodo- | [Molecular Formula]
C9H11IN2O5 | [MOL File]
162239-35-2.mol | [Molecular Weight]
354.1 |
| Chemical Properties | Back Directory | [density ]
2.148±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | [pka]
7.826±0.10(predicted) | [InChI]
InChI=1/C9H11IN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16)/t5,6-,7-/s3 | [InChIKey]
XQFRJNBWHJMXHO-WGPDPFDPNA-N | [SMILES]
N1C(=O)C(I)=CN([C@@H]2CC(O)[C@H](CO)O2)C1=O |&1:7,11,r| |
| Hazard Information | Back Directory | [Description]
Ent-Idoxuridine, also known as 5-iodo-2'-deoxyuridine, is a cytosolic DNA synthesis inhibitor that acts by blocking the conversion of deoxycytidine to deoxyadenosine through the inhibition of the enzyme deoxycytidine kinase. As an enantiomer of idoxuridine, it shares the exact mechanism of action. Notably, ent-idoxuridine is resistant to exonucleases and has demonstrated effectiveness in treating immunodeficiency caused by HIV. | [Uses]
The enantiomer of Idoxuridine (I205750). Antitumor nucleoside enantiomer thymidine kinase used as potential antiviral agents. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList1701258/0_EN.htm |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Website: |
www.carbosynth.com |
|