| Identification | Back Directory | [Name]
(S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl ester | [CAS]
178172-26-4 | [Synonyms]
178172-26-4
Saxagliptin Impurity 51
Saxagliptin Intermediate 1
Ethyl N-Boc-L-proline-4-ene
ethyl N- Boc- 4,5- dehydroprolinate
Ethyl (S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylate
(S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl ester
1-tert-butyl 2-ethyl (2S)-2,3-dihydro-1H-pyrrole-1,2-dicarbo...
(S)-1-tert-Butyl 2-ethyl 2,3-dihydro-1H-pyrrole-1,2-dicarboxylate
1-tert-butyl 2-ethyl (2S)-2,3-dihydro-1H-pyrrole-1,2-dicarboxylate
1-O-tert-butyl 2-O-ethyl (2S)-2,3-dihydropyrrole-1,2-dicarboxylate
1-(tert-butyl) 2-ethyl (S)-2,3-dihydro-1H-pyrrole-1,2-dicarboxylate
(S)-2,3-Dihydropyrrole-1,2-dicarboxylic acid 1-tert-butyl ester 2-ethyl ester
(5S)-4,5-dihydro-1H-pyrrole-1,5-dicarboxylic?acid?1-(1,1-dimethylethyl)-5-ethyl?ester
1H-Pyrrole-1,2-dicarboxylic acid, 2,3-dihydro-, 1-(1,1-dimethylethyl) 2-ethyl ester, (2S)-
(S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl esterQ: What is
(S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl ester Q: What is the CAS Number of
(S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl ester Q: What is the storage condition of
(S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl ester Q: What are the applications of
(S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl ester | [Molecular Formula]
C12H19NO4 | [MDL Number]
MFCD11501326 | [MOL File]
178172-26-4.mol | [Molecular Weight]
241.28 |
| Chemical Properties | Back Directory | [Boiling point ]
315.6±42.0 °C(Predicted) | [density ]
1.125±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [pka]
-2.52±0.40(Predicted) | [InChI]
InChI=1S/C12H19NO4/c1-5-16-10(14)9-7-6-8-13(9)11(15)17-12(2,3)4/h6,8-9H,5,7H2,1-4H3/t9-/m0/s1 | [InChIKey]
AZVLZXHTXUIWRZ-VIFPVBQESA-N | [SMILES]
N1(C(OC(C)(C)C)=O)C=CC[C@H]1C(OCC)=O |
| Hazard Information | Back Directory | [Chemical Properties]
pale yelllow oily liquid | [Uses]
(S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic Acid is used to prepare captopril analogs as inhibitors of angiotensin converting enzyme. It is also used to prepare stereoisomers of DPP-IV inhibitor saxagliptin. |
|
| Company Name: |
Cool Pharm, Ltd
|
| Telephone: |
021-60455363 18019463053 |
| Website: |
www.coolpharm.com |
| Company Name: |
BioPharmaMatrix,Inc.
|
| Telephone: |
0510-86010668 13395169561; |
| Website: |
http://www.biopharmamatrix.com |
|