| Identification | Back Directory | [Name]
4,7,8-TRICHLOROQUINOLINE | [CAS]
17999-80-3 | [Synonyms]
BUTTPARK 177\09-88 4,7,8-TRICHLOROQUINOLINE Quinoline, 4,7,8-trichloro- | [Molecular Formula]
C9H4Cl3N | [MDL Number]
MFCD09787696 | [MOL File]
17999-80-3.mol | [Molecular Weight]
232.49 |
| Chemical Properties | Back Directory | [Boiling point ]
329.2±37.0 °C(Predicted) | [density ]
1.523±0.06 g/cm3(Predicted) | [form ]
solid | [pka]
-0?+-.0.44(Predicted) | [InChI]
InChI=1S/C9H4Cl3N/c10-6-3-4-13-9-5(6)1-2-7(11)8(9)12/h1-4H | [InChIKey]
FSCPDTYVUKZTGT-UHFFFAOYSA-N | [SMILES]
N1C2C(=CC=C(Cl)C=2Cl)C(Cl)=CC=1 |
| Hazard Information | Back Directory | [Application]
Because of its quinoline scaffold, 4,7,8-TRICHLOROQUINOLINE is of significant interest in medicinal chemistry for developing new pharmacologically active agents, and this compound provides a critical entry point for such explorations . Furthermore, quinoline derivatives are investigated in materials science for applications such as organic light-emitting diodes (OLEDs) due to their electronic properties. | [Reactions]
As a multifunctional halogenated heterocycle, 4,7,8-TRICHLOROQUINOLINE is designed for use as a key precursor in the synthesis of more complex molecules. The distinct reactivity of the chlorine atoms at the 4, 7, and 8 positions allows for selective substitution reactions, enabling researchers to construct a diverse array of quinoline-based structures. |
|
|