| Identification | Back Directory | [Name]
(S)-4-(anthracen-9-yl)-3-(te
rt-butyl)-2,3-dihydrobenzo
[d][1,3]oxaphosphole | [CAS]
1807740-34-6 | [Synonyms]
(S)-4-(anthracen-9-yl)-3-(te
rt-butyl)-2,3-dihydrobenzo
[d][1,3]oxaphosphole | [Molecular Formula]
C25H23O3P | [MDL Number]
MFCD31630706 | [MOL File]
1807740-34-6.mol | [Molecular Weight]
370.42 |
| Chemical Properties | Back Directory | [Boiling point ]
525.7±50.0 °C(Predicted) | [storage temp. ]
Inert atmosphere,2-8°C | [form ]
crystal | [color ]
light yellow | [Sensitive ]
air sensitive, store cold | [InChI]
InChI=1S/C25H23OP/c1-25(2,3)27-16-26-22-14-8-13-21(24(22)27)23-19-11-6-4-9-17(19)15-18-10-5-7-12-20(18)23/h4-15H,16H2,1-3H3/t27-/m1/s1 | [InChIKey]
HKAWVLHXUZNLPP-HHHXNRCGSA-N | [SMILES]
O1C2=CC=CC(C3C4=CC=CC=C4C=C4C=3C=CC=C4)=C2[P@](C(C)(C)C)C1 |
| Questions and Answers (Q&A) | Back Directory | [Reactions]
1. Ligand/palladium catalyst for general Miyaura borylation reactions.
2. Ligand/palladium catalyst for general and sterically demanding Suzuki-Miyaura cross-coupling reactions.
3. Ligand/palladium catalyst for aryl-alkyl Suzuki-Miyaura cross-coupling reactions.
4. Ligand/nickel catalyst for intramolecular reductive cyclization’
5. Ligand/palladium catalyst for Dearomative cyclization’
|
| Hazard Information | Back Directory | [Uses]
(S)-AntPhos is a P-chiral monophosphorus ligand used for the asymmetric Suzuki-Miyaura and Miyaura borylation reactions. This ligand is uniquely effective for sterically hindered cross-coupling reactions. | [reaction suitability]
reagent type: ligand |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
| Company Name: |
3A Chemicals
|
| Tel: |
400-668-9898 |
| Website: |
www.3achem.com |
|