| Identification | Back Directory | [Name]
2'-(Bis(3,5-bis(trifluoromethyl)phenyl)phosphino)-3',6'-dimethoxy-N2,N2,N6,N6-tetramethyl-[1,1'-biphenyl]-2,6-diamine | [CAS]
1810068-30-4 | [Synonyms]
2-[Bis(3,5-trifluoromethylphenylphosphino)-3,6-dimethoxy]-2',6'-dimethylamino-1,1'-biphenyl,98% 2-[Bis(3,5-trifluoromethylphenylphosphino)-3,6-dimethoxy]-
2',6'-dimethylamino-1,1'-biphenyl, 98% 2'-(Bis(3,5-bis(trifluoromethyl)phenyl)phosphino)-3',6'-dimethoxy-N2,N2,N6,N6-tetramethyl-[1,1'-biphenyl]-2,6-diamine | [Molecular Formula]
C34H29F12N2O2P | [MDL Number]
MFCD29905024 | [MOL File]
1810068-30-4.mol | [Molecular Weight]
756.56 |
| Chemical Properties | Back Directory | [Melting point ]
160.3°C | [Boiling point ]
611.2±55.0 °C(Predicted) | [storage temp. ]
2-8°C, protect from light, stored under nitrogen | [form ]
Powder | [pka]
4.72±0.28(Predicted) | [color ]
white to off-white | [InChIKey]
RXBSKAKCDMMHNB-UHFFFAOYSA-N | [SMILES]
FC(F)(F)c1cc(cc(c1)C(F)(F)F)P(c3c(ccc(c3c4c(cccc4N(C)C)N(C)C)OC)OC)c2cc(cc(c2)C(F)(F)F)C(F)(F)F |
| Hazard Information | Back Directory | [Uses]
As the Pd G4 complex, this revolutionary ligand from the Buchwald group offers best-in-class performance in the arylation of sterically hindered secondary amines. | [reaction suitability]
reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst reaction type: Cross Couplings reagent type: ligand |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Shanghai UCHEM Inc.
|
| Tel: |
18939844854 |
| Website: |
www.chemicalbook.com/supplier/23967788/ |
|