| Identification | Back Directory | [Name]
2,3',4,4',6-PENTABROMODIPHENYL ETHER | [CAS]
189084-66-0 | [Synonyms]
BDE 119 PBDE 119 BDE NO 119 bde no 119solution 2,3',4,4',6-PENTABDE 2,3',4,4',6-PENTABROMODIPHENYL ETHER 1,3,5-Tribromo-2-(3,4-dibromophenoxy)benzene Benzene, 1,3,5-tribromo-2-(3,4-dibromophenoxy)- 2,3',4,4',6-Pentabromodiphenyl ether (BDE-119) Solution 2,3μ,4,4μ,6-PentaBDE, 2,3μ,4,4μ,6-Pentabromodiphenyl ether solution, PBDE 119 | [EINECS(EC#)]
620-889-4 | [Molecular Formula]
C12H5Br5O | [MDL Number]
MFCD08460507 | [MOL File]
189084-66-0.mol | [Molecular Weight]
564.69 |
| Chemical Properties | Back Directory | [Boiling point ]
433.9±45.0 °C(Predicted) | [density ]
2.343±0.06 g/cm3(Predicted) | [Fp ]
-12 °C | [storage temp. ]
2-8°C | [Major Application]
environmental | [InChI]
1S/C12H5Br5O/c13-6-3-10(16)12(11(17)4-6)18-7-1-2-8(14)9(15)5-7/h1-5H | [InChIKey]
KXEOYBYEJCRPGB-UHFFFAOYSA-N | [SMILES]
Brc1cc(Br)c(Oc2ccc(Br)c(Br)c2)c(Br)c1 | [EPA Substance Registry System]
PBDE 119 (189084-66-0) |
| Hazard Information | Back Directory | [Uses]
PBDE 119 is a polybrominated di-?Ph ether (PBDE), which is a flame retardant often incorporated into many polymers. PBDEs are an environmental pollutant that exhibits potential health risks to humans and wildlife. |
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
AccuStandard Inc
|
| Tel: |
(800) 442-5290 |
| Website: |
www.accustandard.com |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
| Company Name: |
Interchim S.A.
|
| Tel: |
(33) 4 70 03 88 55 |
| Website: |
www.interchim.com |
| Company Name: |
AmXpress
|
| Tel: |
6019-1283 |
| Website: |
www.amxpress.com |
| Company Name: |
Chiron AS
|
| Tel: |
+47 73 87 4490 |
| Website: |
www.chiron.no |
|