| Identification | Back Directory | [Name]
1,1,3,3,5,5,7,7,9,9,11,11,13,13,15,15-Hexadecamethyloctasilo | [CAS]
19095-24-0 | [Synonyms]
| [Molecular Formula]
C16H50O7Si8 | [MDL Number]
MFCD28901346 | [MOL File]
19095-24-0.mol | [Molecular Weight]
579.25 |
| Chemical Properties | Back Directory | [Boiling point ]
105 °C(Press: 0.3 Torr) | [storage temp. ]
2-8°C | [Appearance]
Colorless to off-white Liquid | [InChIKey]
QXHIBROWKKWYFM-UHFFFAOYSA-N | [SMILES]
[Si](O[Si](O[Si](O[Si](O[SiH](C)C)(C)C)(C)C)(C)C)(O[Si](O[Si](O[SiH](C)C)(C)C)(C)C)(C)C |
| Hazard Information | Back Directory | [Uses]
1,15-Dihydrohexadecamethyloctasiloxane is used in method for improving biosynthesis of phytochemicals and antioxidant potential of acorus calamus plant. |
| Spectrum Detail | Back Directory | [Spectrum Detail]
1,1,3,3,5,5,7,7,9,9,11,11,13,13,15,15-Hexadecamethyloctasilo(19095-24-0)1HNMR
|
|
| Company Name: |
Lynnchem
|
| Telephone: |
86-(0)29-85992781 17792393971 |
| Website: |
http://www.lynnchem.com/ |
| Company Name: |
chemmole
|
| Telephone: |
400-168-9330 15013243073 |
| Website: |
http://www.chemmolemall.com/ |
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|