| Identification | Back Directory | [Name]
3,4-BIS(TRIFLUOROMETHYL)NITROBENZENE | [CAS]
1978-20-7 | [Synonyms]
3,4-BIS(TRIFLUOROMETHYL)NITROBENZENE 4-nitro-1,2-di(trifluoromethyl)benzene 4-Nitro-1,2-bis(trifluoromethyl)benzene 1,2-BIS(TRIFLUOROMETHYL)-4-NITROBENZENE Benzene, 4-nitro-1,2-bis(trifluoromethyl)- 3,4-BIS(TRIFLUOROMETHYL)NITROBENZENE, 97% MIN. 3,4-Bis(trifluoromethyl)nitrobenzene AldrichCPR 1,2-Bis(trifluoromethyl)-4-nitrobenzene, alpha,alpha,alpha,alpha',alpha',alpha'-Hexafluoro-4-nitro-o-xylene | [Molecular Formula]
C8H3F6NO2 | [MDL Number]
MFCD00728841 | [MOL File]
1978-20-7.mol | [Molecular Weight]
259.11 |
| Chemical Properties | Back Directory | [Melting point ]
23-25 °C | [Boiling point ]
103-104°C 18mm | [density ]
1.539±0.06 g/cm3(Predicted) | [form ]
solid | [InChI]
1S/C8H3F6NO2/c9-7(10,11)5-2-1-4(15(16)17)3-6(5)8(12,13)14/h1-3H | [InChIKey]
QGNGVSKFAUEJDF-UHFFFAOYSA-N | [SMILES]
FC(F)(F)c1c(ccc(c1)[N+](=O)[O-])C(F)(F)F |
| Hazard Information | Back Directory | [Uses]
3,4-Bis(trifluoromethyl)nitrobenzene is used as reactant in the sythetic preparation of 4,5-bis(trifluoromethyl)benzimidazole. |
|
| Company Name: |
HBCChem, Inc.
|
| Tel: |
+1-510-219-6317 |
| Website: |
www.warehouse-sample-usa.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Cochemical Ltd.
|
| Tel: |
029-86115547 17791676824 |
| Website: |
http://www.cochemical.com |
|