Identification | Back Directory | [Name]
2-BroMo-5-ethylpyridine | [CAS]
19842-08-1 | [Synonyms]
2-BroMo-5-ethylpyridine Pyridine, 2-bromo-5-ethyl- | [Molecular Formula]
C7H8BrN | [MDL Number]
MFCD11869552 | [MOL File]
19842-08-1.mol | [Molecular Weight]
186.05 |
Chemical Properties | Back Directory | [Boiling point ]
120-122℃ (23 Torr) | [density ]
1.413±0.06 g/cm3(Predicted) | [storage temp. ]
Inert atmosphere,2-8°C | [pka]
1.14±0.10(Predicted) | [InChI]
InChI=1S/C7H8BrN/c1-2-6-3-4-7(8)9-5-6/h3-5H,2H2,1H3 | [InChIKey]
MVXBQGHDMSEOGX-UHFFFAOYSA-N | [SMILES]
C1(Br)=NC=C(CC)C=C1 |
Hazard Information | Back Directory | [Uses]
2-BroMo-5-ethylpyridine is a disubstituted pyridine used in the preparation of biologically active compounds such as potential prostacyclin receptor inhibitors.
|
|
Company Name: |
SynAsst Chemical.
|
Tel: |
021-60343070 |
Website: |
www.chemicalbook.com/ShowSupplierProductsList15848/0_EN.htm |
|