| Identification | Back Directory | [Name]
3-Methyl-3-butenyl bromide | [CAS]
20038-12-4 | [Synonyms]
1-Bromo-3-methyl-3-butene
2-Methyl-4-bromo-1-butene
4-Bromo-2-methyl-1-butene
3-Methyl-3-butenyl bromide
1-Butene, 4-bromo-2-methyl-
20038-12-4 3-Methyl-3-butenyl bromide | [Molecular Formula]
C5H9Br | [MDL Number]
MFCD11848510 | [MOL File]
20038-12-4.mol | [Molecular Weight]
149.03 |
| Chemical Properties | Back Directory | [Melting point ]
-106.7°C (estimate) | [Boiling point ]
125℃ | [density ]
1.250 | [refractive index ]
1.4600 | [Fp ]
26℃ | [storage temp. ]
2-8°C | [solubility ]
Acetone (Slightly), Chloroform, Ethyl Acetate (Slightly), Methanol (Slightly) | [form ]
Oil | [color ]
Colourless to Light Yellow | [InChI]
InChI=1S/C5H9Br/c1-5(2)3-4-6/h1,3-4H2,2H3 | [InChIKey]
IZMWJUPSQXIVDN-UHFFFAOYSA-N | [SMILES]
C=C(C)CCBr |
| Hazard Information | Back Directory | [Uses]
4-Bromo-2-methyl-1-butene is an substituent in the synthesis of Ryanodol, a potent modulator of the calcium release channels. |
|
| Company Name: |
Letopharm Limited
|
| Telephone: |
+86-21-5821 5861 |
| Website: |
www.letopharm.com |
| Company Name: |
Struchem Co., Ltd.
|
| Telephone: |
0512-63009836 18994340901 |
| Website: |
http://www.beidapharma.com |
| Company Name: |
Rhawn Reagent
|
| Telephone: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Telephone: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
|