| Identification | Back Directory | [Name]
L-LEUCINE-2-13C | [CAS]
201612-66-0 | [Synonyms]
15N, 95-99%)
L-LEUCINE-2-13C
L-LEUCINE-2-13C, 99 ATOM % 13C | [Molecular Formula]
C6H13NO2 | [MDL Number]
MFCD00144627 | [MOL File]
201612-66-0.mol | [Molecular Weight]
132.18 |
| Chemical Properties | Back Directory | [Melting point ]
>300 °C(lit.) | [form ]
solid | [Optical Rotation]
[α]25/D +14.5°, c = 2 in 5 M HCl | [InChI]
1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i5+1 | [InChIKey]
ROHFNLRQFUQHCH-IJPZVAHNSA-N | [SMILES]
[H][13C@](N)(CC(C)C)C(O)=O |
| Hazard Information | Back Directory | [Uses]
L-Leucine-2-13C is the 13C-labeled L-Leucine. L-Leucine is an essential branched-chain amino acid (BCAA), which activates the mTOR signaling pathway[1]. | [References]
[1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
| Company Name: |
Medical Isotopes
|
| Tel: |
1-(603) 635-1722 |
| Website: |
www.medicalisotopes.com |
|