| Identification | Back Directory | [Name]
L-ISOLEUCINE (U-13C6,15N) | [CAS]
202468-35-7 | [Synonyms]
L-Isoleucine-13C?,1?N L-ISOLEUCINE-13C6, 15N L-ISOLEUCINE (U-13C6,15N) 13C and 15N Labeled L-isoleucine (2S,3S)-2-Amino-3-methylpentanoic acid-13C6,15N L-Isoleucine-13C6,15N 98 atom % 13C, 98 atom % 15N, 95% (CP) | [Molecular Formula]
C6H13NO2 | [MDL Number]
MFCD00144621 | [MOL File]
202468-35-7.mol | [Molecular Weight]
138.24 |
| Chemical Properties | Back Directory | [Melting point ]
168-170 °C(lit.) | [storage temp. ]
Refrigerator, under inert atmosphere | [solubility ]
Aqueous Acid (Slightly), Methanol (Slightly, Heated, Sonicated), Water (Slightly) | [form ]
Solid | [color ]
White to Off-White | [Optical Rotation]
[α]25/D +40.0°, c =2 in 5 M HCl | [InChI]
1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1 | [InChIKey]
ROHFNLRQFUQHCH-HUEJSTCGSA-N | [SMILES]
[13CH3][13CH]([13CH3])[13CH2][13C@H]([15NH2])[13C](O)=O |
| Hazard Information | Back Directory | [Uses]
L-Isoleucine-13C6,15N is used in the immunocapture isotope dilution mass spectrometry (IC-IDMS) to evaluate the suitability of the underlying monoclonal andpolyclonal antibodies (mAbs and pAbs) for new vaccine quantification. | [General Description]
L-isoleucine is an essential amino acid that is synthesized from threonine. It is a branched-chain hydrophobic amino acid. L-isoleucine is an isomer of L-leucine. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|