| Identification | Back Directory | [Name]
2-Chloro-6-mercaptobenzoic acid | [CAS]
20324-51-0 | [Synonyms]
2-Chloro-6-mercaptobenzoic acid
6-Chloro-2-mercaptobenzoic acid
2-Mercapto-6-Chloro Benzoic Acid
Benzoic acid, 2-chloro-6-Mercapto- | [EINECS(EC#)]
1312995-182-4 | [Molecular Formula]
C7H5ClO2S | [MOL File]
20324-51-0.mol | [Molecular Weight]
188.63 |
| Chemical Properties | Back Directory | [Boiling point ]
323.2±27.0 °C(Predicted) | [density ]
1.490 | [pka]
2.35±0.36(Predicted) | [InChI]
InChI=1S/C7H5ClO2S/c8-4-2-1-3-5(11)6(4)7(9)10/h1-3,11H,(H,9,10) | [InChIKey]
AQKPOJRMYFQSLX-UHFFFAOYSA-N | [SMILES]
C(O)(=O)C1=C(S)C=CC=C1Cl |
| Hazard Information | Back Directory | [Uses]
2-??Chloro-??6-??mercaptobenzoic Acid is a useful research chemical used in the preparation and synthesis of acetophenone oxime esters of pyrithiobac as potential herbicides. |
|
| Company Name: |
Flavi Pharma
|
| Tel: |
+91-8583858185 +91-9637442284 |
| Website: |
www.flavi-pharma.com |
| Company Name: |
Candia Thamtech Company Limited
|
| Tel: |
0371-86615086 18203638366 0371-86159066 13526786601 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15771/0.htm |
| Company Name: |
Megchem Co., Ltd.
|
| Tel: |
+86 (21) 5471-7132 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList16148/0.htm |
|