| Identification | Back Directory | [Name]
Nickel(2+), tetraaqua[4,4'-bis(1,1-dimethylethyl)-2,2'-bipyridine-κN1,κN1']-, chloride (1:2), (OC-6-22)- | [CAS]
2035424-75-8 | [Synonyms]
Ni(dtbbpy)(H2O)4]Cl2
Nickel(2+), tetraaqua[4,4'-bis(1,1-dimethylethyl)-2,2'-bipyridine-κN1,κN1']-, chloride (1:2), (OC-6-22)-
Nickel(2+), tetraaqua[4,4'-bis(1,1-dimethylethyl)-2,2'-bipyridine-κN1,κN1']-, chloride (1:2), (OC-6-22)- | [Molecular Formula]
C18H28ClN2NiO4+ | [MOL File]
2035424-75-8.mol | [Molecular Weight]
430.57 |
| Chemical Properties | Back Directory | [Melting point ]
>300°C | [form ]
powder | [InChIKey]
UTKNAEDPSHMNCR-UHFFFAOYSA-J | [SMILES]
[Ni+2]1([NH]2=CC=C(C=C2C3=CC(=CC=[NH]31)C(C)(C)C)C(C)(C)C)(O)(O)(O)O.C |
| Hazard Information | Back Directory | [Uses]
[Ni(dtbbpy)(H2O)4]Cl2 is a Ni precatalyst used in a series of Ni/photoredox dual catalysis cross-coupling reactions. These transformations include the decarboxylative coupling of oxetanyl amino acids with aryl halides. | [reaction suitability]
reagent type: catalyst
reaction type: Cross Couplings |
|
| Company Name: |
Shanghai UCHEM Inc.
|
| Tel: |
18939844854 |
| Website: |
www.chemicalbook.com/supplier/23967788/ |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|