| Identification | Back Directory | [Name]
BIS(4-METHOXYPHENYL)PHOSPHINIC ACID | [CAS]
20434-05-3 | [Synonyms]
LABOTEST-BB LT00452953 BIS(4-METHOXYPHENYL)PHOSPHINIC ACID Bis(4-methoxyphenyl)phosphinic acid 99% Phosphinic acid, P,P-bis(4-methoxyphenyl)- | [Molecular Formula]
C14H15O4P | [MDL Number]
MFCD00010226 | [MOL File]
20434-05-3.mol | [Molecular Weight]
278.24 |
| Chemical Properties | Back Directory | [Melting point ]
185-187 °C(lit.)
| [Boiling point ]
504.1±50.0 °C(Predicted) | [density ]
1.27±0.1 g/cm3(Predicted) | [storage temp. ]
Hygroscopic, -20°C Freezer, Under inert atmosphere | [solubility ]
DMSO (Slightly), Methanol (Slightly) | [form ]
Solid | [pka]
2.06±0.58(Predicted) | [color ]
White to Off-White | [InChI]
InChI=1S/C14H15O4P/c1-17-11-3-7-13(8-4-11)19(15,16)14-9-5-12(18-2)6-10-14/h3-10H,1-2H3,(H,15,16) | [InChIKey]
BFPBWJGVRNQWEK-UHFFFAOYSA-N | [SMILES]
P(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)(O)=O |
| Hazard Information | Back Directory | [Uses]
Bis(4-methoxyphenyl)phosphinic acid was used to treat the chemical surface of porphyrin-sensitised titania films after dye adsorption to enhance the efficiency of dye-sensitized solar cells (DSSC). | [Uses]
Bis(4-methoxyphenyl)phosphinic Acid acts as a reagent in the synthesis of phosphonic acids, aromatic phosphonic acids and their derivatives. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|