| Identification | Back Directory | [Name]
4-methyl-1-phenylpentan-1-one | [CAS]
2050-07-9 | [Synonyms]
Isopentyl(phenyl) ketone 4-methyl-1-phenylpentan-1-one 1-Phenyl-4-methyl-1-pentanone 4-Methyl-1-phenyl-1-pentanone 1-Phenyl-4-methylpentane-1-one 1-Pentanone, 4-methyl-1-phenyl- | [EINECS(EC#)]
218-079-7 | [Molecular Formula]
C12H16O | [MDL Number]
MFCD00026524 | [MOL File]
2050-07-9.mol | [Molecular Weight]
176.25 |
| Chemical Properties | Back Directory | [Melting point ]
-1°C | [Boiling point ]
255.5°C (estimate) | [density ]
0.9623 | [refractive index ]
1.5330 (estimate) | [solubility ]
soluble in Chloroform | [form ]
Oil | [color ]
Colorless | [InChI]
InChI=1S/C12H16O/c1-10(2)8-9-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 | [InChIKey]
WRJZDDJYWWJLIS-UHFFFAOYSA-N | [SMILES]
C(C1=CC=CC=C1)(=O)CCC(C)C |
| Hazard Information | Back Directory | [Uses]
4-Methyl-valerophenone is an intermediate used in the synthesis of a-Pyrrolidinoisohexanophenone (Hydrochloride) (P841230), which is a phenone derivative used for research purposes. |
|
| Company Name: |
HASWELL Gold
|
| Telephone: |
13951186658 |
| Website: |
www.haswell.com |
| Company Name: |
TaiChem Taizhou Limited
|
| Telephone: |
052386810091 |
| Website: |
https://www.chemicalbook.com/supplier/11410902/1.htm |
| Company Name: |
Labnetwork lnc.
|
| Telephone: |
+86-27-50766799 +86-18062016861 |
| Website: |
www.labnetwork.com |
| Company Name: |
Shaanxi Dideu Medichem Co. Ltd
|
| Telephone: |
+86-29-81139210 17389186172 |
| Website: |
https://www.chemicalbook.com/manufacturer/shaanxi-dideu-medichem-219/ |
|