| Identification | Back Directory | [Name]
5-Bromo-1-methylisatin | [CAS]
2058-72-2 | [Synonyms]
5-Bromo-1-methylisatin 5-bromo-1-methylindole-2,3-dione 5-bromo-1-methyl-indole-2,3-dione 5-Bromo-1-methylindoline-2,3-dione 1-Methyl-5-bromo-2,3-indolinedione 1-Methyl-5-bromoindoline-2,3-dione 5-Bromo-1-methyl-2,3-indolinedione INDOLE-2,3-DIONE, 5-BROMO-1-METHYL- 5-Bromo-1-methyl-1H-indole-2,3-dione 1-Methyl-5-bromo-1H-indole-2,3-dione 1H-Indole-2,3-dione, 5-bromo-1-methyl- 1-Methyl-5-bromo-2,3-dihydro-1H-indole-2,3-dione 5-bromo-1-methyl-1H-indole-2,3-dione(SALTDATA: FREE) | [Molecular Formula]
C9H6BrNO2 | [MDL Number]
MFCD00456313 | [MOL File]
2058-72-2.mol | [Molecular Weight]
240.06 |
| Chemical Properties | Back Directory | [Melting point ]
169.0 to 173.0 °C | [Boiling point ]
362.6±44.0 °C(Predicted) | [density ]
1.729±0.06 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,Room Temperature | [form ]
powder to crystal | [pka]
-3.33±0.20(Predicted) | [color ]
White to Yellow to Orange | [InChI]
1S/C9H6BrNO2/c1-11-7-3-2-5(10)4-6(7)8(12)9(11)13/h2-4H,1H3 | [InChIKey]
GEEDYJPPYNIZLX-UHFFFAOYSA-N | [SMILES]
O=C(C1=CC(Br)=CC=C1N2C)C2=O |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
|