| Identification | Back Directory | [Name]
2-Chloro-6-hydroxymethyl-pyridin-3-ol | [CAS]
208519-41-9 | [Synonyms]
2-Chloro-6-hydroxymethyl-pyridin-3-ol 2-Pyridinemethanol, 6-chloro-5-hydroxy- | [Molecular Formula]
C6H6ClNO2 | [MDL Number]
MFCD12922671 | [MOL File]
208519-41-9.mol | [Molecular Weight]
159.57 |
| Chemical Properties | Back Directory | [Melting point ]
133~135℃ | [Boiling point ]
407.6±40.0 °C(Predicted) | [density ]
1.493±0.06 g/cm3(Predicted) | [storage temp. ]
under inert gas (nitrogen or Argon) at 2-8°C | [pka]
4.24±0.10(Predicted) | [InChI]
InChI=1S/C6H6ClNO2/c7-6-5(10)2-1-4(3-9)8-6/h1-2,9-10H,3H2 | [InChIKey]
NQELPILICRHYOE-UHFFFAOYSA-N | [SMILES]
C1(CO)=NC(Cl)=C(O)C=C1 |
| Hazard Information | Back Directory | [Description]
2-Chloro-6-hydroxymethyl-pyridin-3-ol is a pharmaceutical intermediate compound that can be used to prepare Mcl1 inhibitors. | [Uses]
2-Chloro-6-(hydroxymethyl)-3-pyridinol is useful reagent for stereoselective preparation of furopyridylethylthiopyrimidine HIV-1 reverse transcriptase inhbitors. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
China Langchem Inc.
|
| Tel: |
0086-21-58956006 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList19141/0_EN.htm |
|