| Identification | Back Directory | [Name]
10-[2-(2-Methoxyethoxy)ethyl]-10H-phenothiazine | [CAS]
2098786-35-5 | [Synonyms]
MEEPT 10-[2-(2-Methoxyethoxy)ethyl]-10H-phenothiazine | [Molecular Formula]
C17H19NO2S | [MDL Number]
MFCD31618147 | [MOL File]
2098786-35-5.mol | [Molecular Weight]
301.4 |
| Chemical Properties | Back Directory | [Boiling point ]
434.9±38.0 °C(Predicted) | [density ]
1.175±0.06 g/cm3(Predicted) | [refractive index ]
1.6260 to 1.6300 | [storage temp. ]
2-8°C, protect from light | [form ]
clear liquid | [pka]
0.26±0.20(Predicted) | [color ]
Light yellow to Yellow to Orange | [InChI]
InChI=1S/C17H19NO2S/c1-19-12-13-20-11-10-18-14-6-2-4-8-16(14)21-17-9-5-3-7-15(17)18/h2-9H,10-13H2,1H3 | [InChIKey]
XWOTZCDVQAKOAY-UHFFFAOYSA-N | [SMILES]
C1=C2C(SC3=C(N2CCOCCOC)C=CC=C3)=CC=C1 |
|
| Company Name: |
Henan Alpha Chemical Co., Ltd.
|
| Telephone: |
0371-55055611 18137792234 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList31206/0.htm |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
|