| Identification | Back Directory | [Name]
[(2-{Bis[3,5-bis(trifluoromethyl)phenyl]phosphine}-3,6-dimethoxy- 2′,4′,6′- triisopropyl-1,1′-biphenyl )-2-(2′-amino-1,1′-biphenyl)]palladium(II) methanesulfonate | [CAS]
2102544-35-2 | [Synonyms]
JackiePhos Pd G3
JackiePhos-Pd-G3
Methanesulfonato[2-bis(3,5-di(trifluoromethyl)phenylphosphino)-3,6-dimethoxy-2'',4'',6''-tri-i-propyl-1,1''-biphenyl](2''-amino-1,1''-biphenyl-2-yl)palladium(II)
Methanesulfonato[2-bis(3,5-di(trifluoromethyl)phenylphosphino)-3,6-dimethoxy-2'',4'',6''-tri-i-propyl-1,1''-biphenyl](2''-amino-1,1''-biphenyl-2-yl)palladium(II)
[(2-{Bis[3,5-bis(trifluoromethyl)phenyl]phosphine}-3,6-dimethoxy- 2′,4′,6′- triisopropyl-1,1′-biphenyl )-2-(2′-amino-1,1′-biphenyl)]palladium(II) methanesulfonate
2'-(Amino-κN)[1,1'-biphenyl]-2-yl-κC][bis[3,5-bis(trifluoromethyl)phenyl][3,6-dimethoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine-κP](methanesulfonato-κO)palladium
2'-(Amino-κN)[1,1'-biphenyl]-2-yl-κC][bis[3,5-bis(trifluoromethyl)phenyl][3,6-dimethoxy-2',4',6'-tris(1-methylethyl)[1,1'-biphenyl]-2-yl]phosphine-κP](methanesulfonato-κO)palladium
Methanesulfonato[2-bis(3,5-di(trifluoromethyl)phenylphosphino)-3,6-dimethoxy-2',4',6'-tri-i-propyl-1,1'-biphenyl](2'-amino-1,1'-biphenyl-2-yl)palladium(II), min. 98% [JackiePhos Palladacycle Gen. 3] | [Molecular Formula]
C52H50F12NO5PPdS | [MDL Number]
MFCD22572672 | [MOL File]
2102544-35-2.mol | [Molecular Weight]
1166.41 |
| Chemical Properties | Back Directory | [Melting point ]
195-197 °C (decomposition) | [storage temp. ]
2-8°C, protect from light, stored under nitrogen | [form ]
solid | [Appearance]
White to light brown Solid | [InChIKey]
LLXGRQGGARSAOC-UHFFFAOYSA-M | [SMILES]
CS(=O)(=O)O[Pd]c1ccccc1-c2ccccc2N.COc3ccc(OC)c(c3P(c4cc(cc(c4)C(F)(F)F)C(F)(F)F)c5cc(cc(c5)C(F)(F)F)C(F)(F)F)-c6c(cc(cc6C(C)C)C(C)C)C(C)C |
| Hazard Information | Back Directory | [Uses]
JackiePhos Pd G3 can be used as a palladium precatalyst in Stille cross-coupling reaction between organostannane and ary halides. | [reaction suitability]
core: palladium
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst
reaction type: Cross Couplings |
| Spectrum Detail | Back Directory | [Spectrum Detail]
[(2-{Bis[3,5-bis(trifluoromethyl)phenyl]phosphine}-3,6-dimethoxy- 2′,4′,6′- triisopropyl-1,1′-biphenyl )-2-(2′-amino-1,1′-biphenyl)]palladium(II) methanesulfonate(2102544-35-2)31PNMR
[(2-{Bis[3,5-bis(trifluoromethyl)phenyl]phosphine}-3,6-dimethoxy- 2′,4′,6′- triisopropyl-1,1′-biphenyl )-2-(2′-amino-1,1′-biphenyl)]palladium(II) methanesulfonate(2102544-35-2)19FNMR
|
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
LaaJoo
|
| Telephone: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
| Company Name: |
Henan Alpha Chemical Co., Ltd.
|
| Telephone: |
0371-55055611 18137792234 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList31206/0.htm |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|