| Identification | Back Directory | [Name]
trans-4-(methylamino)cyclohexyl)methanesulfonic acid | [CAS]
2124221-12-9 | [Synonyms]
trans-4-(methylamino)cyclohexyl)methanesulfonic acid Cyclohexanemethanesulfonic acid, 4-(methylamino)-, trans- | [Molecular Formula]
C8H17NO3S | [MDL Number]
MFCD32068268 | [MOL File]
2124221-12-9.mol | [Molecular Weight]
207.29 |
| Chemical Properties | Back Directory | [density ]
1.22±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C, sealed storage, away from moisture and light | [pka]
1.75±0.50(Predicted) | [Appearance]
White to off-white Solid | [InChI]
InChI=1S/C8H17NO3S/c1-9-8-4-2-7(3-5-8)6-13(10,11)12/h7-9H,2-6H2,1H3,(H,10,11,12)/t7-,8- | [InChIKey]
VFGKCJQWKDYLOI-ZKCHVHJHSA-N | [SMILES]
[C@@H]1(CS(O)(=O)=O)CC[C@@H](NC)CC1 |
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|