| Identification | Back Directory | [Name]
2-(2-bromoisobutyryloxy)ethyl methacrylate | [CAS]
213453-08-8 | [Synonyms]
BIEM 2-(2-bromoisobutyryloxy)ethyl methacrylate 2-(2-BroMoisobutyryloxy)ethyl Methacrylate 95% 2-((2-Bromo-2-methylpropanoyl)oxy)ethyl methacrylate 2-(2-methylprop-2-enoyloxy)ethyl 2-bromo-2-methylpropanoate 2-Propenoic acid, 2-methyl-, 2-(2-bromo-2-methyl-1-oxopropoxy)ethyl ester | [EINECS(EC#)]
683-599-7 | [Molecular Formula]
C10H15BrO4 | [MDL Number]
MFCD18785732 | [MOL File]
213453-08-8.mol | [Molecular Weight]
279.13 |
| Chemical Properties | Back Directory | [Boiling point ]
318.1±22.0 °C(Predicted) | [density ]
1.303 g/mL at 25 °C | [refractive index ]
n20/D1.471 | [Fp ]
>110℃ | [storage temp. ]
2-8°C | [form ]
liquid | [Appearance]
Colorless to light yellow Liquid | [InChI]
InChI=1S/C10H15BrO4/c1-7(2)8(12)14-5-6-15-9(13)10(3,4)11/h1,5-6H2,2-4H3 | [InChIKey]
QXDYJUSFCUKOQD-UHFFFAOYSA-N | [SMILES]
C(OCCOC(=O)C(Br)(C)C)(=O)C(C)=C |
| Hazard Information | Back Directory | [Uses]
Atom Transfer Radical Polymerization (ATRP) initiator with a methacrylate functionality for branched polymerization, orthogonal polymerization, or other functionalization. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|