| Identification | Back Directory | [Name]
5-(4-(4-(Prop-2-yn-1-yloxy)benzoyl)phenoxy)pentanoic acid | [CAS]
2140866-79-9 | [Synonyms]
5-(4-(4-(Prop-2-yn-1-yloxy)benzoyl)phenoxy)pentanoic acid Pentanoic acid, 5-[4-[4-(2-propyn-1-yloxy)benzoyl]phenoxy]- | [Molecular Formula]
C21H20O5 | [MOL File]
2140866-79-9.mol | [Molecular Weight]
352.38 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [form ]
solid | [InChI]
1S/C21H20O5/c1-2-14-25-18-10-6-16(7-11-18)21(24)17-8-12-19(13-9-17)26-15-4-3-5-20(22)23/h1,6-13H,3-5,14-15H2,(H,22,23) | [InChIKey]
PVDBYWSDYKTIBJ-UHFFFAOYSA-N | [SMILES]
O(CCCCC(=O)O)c1ccc(cc1)C(=O)c2ccc(cc2)OCC#C |
| Hazard Information | Back Directory | [Uses]
5-(4-(4-(Prop-2-yn-1-yloxy)benzoyl)phenoxy)pentanoic acid is used for chemical probe synthesis, this trifunctional building block contains a light-activated benzophenone, alkyne tag, and carboxylic acid synthetic handle. When appended to a ligand or pharmacophore through its acid linker, this building block allows for UV light-induced covalent modification of a biological target with potential for downstream applications via the alkyne tag. Use alone or in parallel with other multi-functional building blocks to discover the optimal probe for your chemical biology experiments. | [Application]
5-(4-(4-(Prop-2-yn-1-yloxy)benzoyl)phenoxy)pentanoic acid can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process. | [reaction suitability]
reaction type: click chemistry |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
A.J Chemicals
|
| Tel: |
91-9810153283 |
| Website: |
www.ajchemicals.com |
|