| Identification | Back Directory | [Name]
Dibenzofuran, 1-bromo-8-chloro- | [CAS]
2173554-83-9 | [Synonyms]
1-bromo-8-chloro-dibenzofuran Dibenzofuran, 1-bromo-8-chloro- 1-Bromo-8-chlorodibenzo[b,d]furan | [Molecular Formula]
C12H6BrClO | [MDL Number]
MFCD32670065 | [MOL File]
2173554-83-9.mol | [Molecular Weight]
281.53 |
| Chemical Properties | Back Directory | [Boiling point ]
376.4±22.0 °C(Predicted) | [density ]
1.669±0.06 g/cm3(Predicted) | [storage temp. ]
Keep in dark place,Sealed in dry,Room Temperature | [InChI]
InChI=1S/C12H6BrClO/c13-9-2-1-3-11-12(9)8-6-7(14)4-5-10(8)15-11/h1-6H | [InChIKey]
LMGAQFSQAOXEDZ-UHFFFAOYSA-N | [SMILES]
O1C2=CC=C(Cl)C=C2C2=C(Br)C=CC=C12 |
| Hazard Information | Back Directory | [Uses]
1-Bromo-8-chlorodibenzo[b,d]furan is a notable chemical compound with significant organic synthesis and materials science applications. Its distinctive fused-ring structure, incorporating bromine and chlorine atoms, offers unique reactivity for various chemical transformations. This compound is a devate of Dibenzofuran and a good electron donor. |
|
|