| Identification | Back Directory | [Name]
2-chloro-4,6-di-p-tolyl-1,3,5-triazine | [CAS]
21902-34-1 | [Synonyms]
2-chloro-4,6-di-p-tolyl-1,3,5-triazine 2-chloro-4,6-bis(4-methylphenyl)-1,3,5-triazine 1,3,5-Triazine, 2-chloro-4,6-bis(4-methylphenyl)- | [Molecular Formula]
C17H14ClN3 | [MDL Number]
MFCD29071841 | [MOL File]
21902-34-1.mol | [Molecular Weight]
295.77 |
| Chemical Properties | Back Directory | [Melting point ]
208 °C | [Boiling point ]
496.5±48.0 °C(Predicted) | [density ]
1.211±0.06 g/cm3(Predicted) | [storage temp. ]
under inert gas (nitrogen or Argon) at 2-8°C | [form ]
powder to crystal | [pka]
0.18±0.10(Predicted) | [color ]
White to Almost white | [InChI]
InChI=1S/C17H14ClN3/c1-11-3-7-13(8-4-11)15-19-16(21-17(18)20-15)14-9-5-12(2)6-10-14/h3-10H,1-2H3 | [InChIKey]
LPSLMIOUKRPZDC-UHFFFAOYSA-N | [SMILES]
N1=C(C2=CC=C(C)C=C2)N=C(C2=CC=C(C)C=C2)N=C1Cl | [CAS DataBase Reference]
21902-34-1 |
|
| Company Name: |
TCI Chemicals
|
| Telephone: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
|