| Identification | Back Directory | [Name]
2212021-83-3 | [CAS]
2212021-83-3 | [Synonyms]
5-[(S)-2,2-Dimethyltetrahydro-2H-pyran-4-yl]-1-[(1S,2S)-2-methyl-1-(5-oxo-4,5-dihydro-1,2,4-oxadiazol-3-yl)cyclopropyl]-1H-indole-2-carboxylic Acid
1H-Indole-2-carboxylic acid, 1-[(1S,2S)-1-(2,5-dihydro-5-oxo-1,2,4-oxadiazol-3-yl)-2-methylcyclopropyl]-5-[(4S)-tetrahydro-2,2-dimethyl-2H-pyran-4-yl]- | [Molecular Formula]
C22H25N3O5 | [MOL File]
2212021-83-3.mol | [Molecular Weight]
411.46 |
| Chemical Properties | Back Directory | [density ]
1.48±0.1 g/cm3(Predicted) | [form ]
Solid | [pka]
4.55±0.30(Predicted) | [color ]
White to off-white | [InChIKey]
VWANSYGDVGYGTG-ODJFAWIYNA-N | [SMILES]
C[C@H]1C[C@]1(C1=NOC(=O)N1)N1C(=CC2=CC([C@H]3CCOC(C)(C)C3)=CC=C12)C(=O)O |&1:1,3,16,r| |
| Hazard Information | Back Directory | [Chemical Properties]
White to off-white Solid | [Uses]
5-((S)-2,2-Dimethyltetrahydro-2H-pyran-4-yl)-1-((1S,2S)-2-methyl-1-(5-oxo-4,5-dihydro-1,2,4-oxadiazol-3-yl)cyclopropyl)-1H-indole-2-carboxylic acid is a biological molecule. | [General Description]
5-((S)-2,2-Dimethyltetrahydro-2H-pyran-4-yl)-1-((1S,2S)-2-methyl-1-(5-oxo-4,5-dihydro-1,2,4-oxadiazol-3-yl)cyclopropyl)-1H-indole-2-carboxylic acid is a biological molecule. | [Pharmaceutical Applications]
This compound has potential applications in the field of medicinal chemistry, particularly as an anti-inflammatory or anti-cancer agent. Indole derivatives have been shown to interact with various enzymes and receptors involved in disease pathways. The presence of the cyclopropyl and oxadiazole groups can enhance binding to target proteins and improve metabolic stability. Additionally, the tetrahydropyran group contributes to the compound's overall pharmacological profile, making it suitable for further development and optimization in drug discovery programs. |
|
|