| Identification | Back Directory | [Name]
MorDalphos Pd G3 | [CAS]
2222690-89-1 | [Synonyms]
MorDalphos Pd G3
Methanesulfonato{N-[2-(di-1-adamantylphosphino)phenyl]morpholine}(2'-amino-1,1'-biphenyl-2-yl)palladium(II) dichloromethane adduct | [Molecular Formula]
C43H55N2O4PPdS | [MDL Number]
MFCD28137452 | [MOL File]
2222690-89-1.mol | [Molecular Weight]
833.38 |
| Chemical Properties | Back Directory | [Melting point ]
245-250°C | [storage temp. ]
2-8°C, protect from light | [form ]
solid | [Appearance]
White to yellow Solid | [InChIKey]
XDLJAOATDSJDKP-UHFFFAOYSA-M | [SMILES]
NC1=C(C=CC=C1)C2=C([Pd]OS(=O)(C)=O)C=CC=C2.P([C@]34C[C@@H](C[C@@H](C4)C5)C[C@@H]5C3)([C@@]6(C[C@@H](C7)C8)C[C@H]7C[C@H]8C6)C9=CC=CC=C9N%10CCOCC%10 |
| Hazard Information | Back Directory | [Uses]
MorDalphos Pd G3 is a third generation (G3) Buchwald precatalyst. It is air, moisture and thermally-stable and is highly soluble in a wide range of common organic solvents. It has long life in solutions. MorDalphos Pd G3 is an excellent reagent for palladium catalyzed cross-coupling reactions. Some of its unique features include lower catalyst loadings, shorter reaction time, efficient formation of the active catalytic species and accurate control of ligand: palladium ratio. | [General Description]
MorDalphos Pd G3 is a third generation (G3) Buchwald precatalyst. It is air, moisture and thermally-stable and is highly soluble in a wide range of common organic solvents. It has long life in solutions. MorDalphos Pd G3 is an excellent reagent for palladium catalyzed cross-coupling reactions. Some of its unique features include lower catalyst loadings, shorter reaction time, efficient formation of the active catalytic species and accurate control of ligand: palladium ratio. | [reaction suitability]
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst
reaction type: Cross Couplings |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|