| Identification | Back Directory | [Name]
9,9-Dimethyl-2,7-bis[N-(1-naphthyl)-N-phenylamino]fluorene | [CAS]
222319-05-3 | [Synonyms]
2,7-Bis[N-(1-naphthyl)anilino]-9,9-dimethylfluorene 2,7-Bis[N-(1-naphthyl)anilino]-9,9-dimethylfluorene 9,9-Dimethyl-2,7-bis[N-(1-naphthyl)-N-phenylamino]fluorene 9,9-Dimethyl-N,N′-di(1-naphthyl)-N,N′-diphenyl-9H-fluorene-2,7-diamine 9,9-dimethyl-2-N,7-N-dinaphthalen-1-yl-2-N,7-N-diphenylfluorene-2,7-diamine 9,9-dimethyl-N2,N7-di(naphthalen-1-yl)-N2,N7-diphenyl-9H-fluorene-2,7-diamine | [Molecular Formula]
C47H36N2 | [MDL Number]
MFCD11110702 | [MOL File]
222319-05-3.mol | [Molecular Weight]
628.8 |
| Chemical Properties | Back Directory | [Melting point ]
265-270°C | [density ]
1?+-.0.06 g/cm3(Predicted) | [storage temp. ]
RT, protect from light | [form ]
powder to crystal | [pka]
-0.14±0.40(Predicted) | [color ]
White to Orange to Green | [InChIKey]
KJEQVQJWXVHKGT-UHFFFAOYSA-N | [SMILES]
C1(C)(C)C2=C(C=CC(N(C3=C4C(C=CC=C4)=CC=C3)C3=CC=CC=C3)=C2)C2=C1C=C(N(C1=C3C(C=CC=C3)=CC=C1)C1=CC=CC=C1)C=C2 |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
TCI Chemicals
|
| Telephone: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
|