| Chemical Properties | Back Directory | [Melting point ]
150-155°C (decompose with no melt) | [storage temp. ]
2-8°C, protect from light | [form ]
solid | [Appearance]
Light yellow to green yellow Solid | [InChIKey]
VEUUEPDQCSBCQL-UHFFFAOYSA-M | [SMILES]
NC1=C(C=CC=C1)C2=C([Pd]OS(C)(=O)=O)C=CC=C2.CC(C)(C)P(C3=CC=C4C(C=CC=C4)=C3C5=CC=CC6=C5C=CC=C6)C(C)(C)C |
| Hazard Information | Back Directory | [reaction suitability]
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst
reaction type: Cross Couplings |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|