| | Identification | Back Directory |  | [Name] 
 3-chloro-2-methoxy-5-nitropyridine
 |  | [CAS] 
 22353-53-3
 |  | [Synonyms] 
 3-chloro-2-methoxy-5-nitropyridine
 Pyridine, 3-chloro-2-methoxy-5-nitro-
 |  | [Molecular Formula] 
 C6H5ClN2O3
 |  | [MDL Number] 
 MFCD18254096
 |  | [MOL File] 
 22353-53-3.mol
 |  | [Molecular Weight] 
 188.57
 | 
 | Chemical Properties | Back Directory |  | [Melting point ] 
 63-64 °C
 |  | [Boiling point ] 
 267.0±35.0 °C(Predicted)
 |  | [density ] 
 1.445±0.06 g/cm3(Predicted)
 |  | [storage temp. ] 
 Inert atmosphere,Room Temperature
 |  | [pka] 
 -2.92±0.20(Predicted)
 |  | [Appearance] 
 Light yellow to yellow Solid
 |  | [InChI] 
 InChI=1S/C6H5ClN2O3/c1-12-6-5(7)2-4(3-8-6)9(10)11/h2-3H,1H3
 |  | [InChIKey] 
 NYAXJWLJSVLTIX-UHFFFAOYSA-N
 |  | [SMILES] 
 C1(OC)=NC=C([N+]([O-])=O)C=C1Cl
 | 
 | Hazard Information | Back Directory |  | [Synthesis] 
 
 1. To a solution of 2,3-dichloro-5-nitropyridine (50 mg) in methanol (1 ml) was slowly added sodium methanol (5 M methanol solution, 0.5 ml) at room temperature. 2. The reaction mixture was stirred continuously at room temperature for 1.5 h. 3. Upon completion of the reaction, an appropriate amount of water was added to the mixture and the mixture was extracted with ethyl acetate. 4. The organic phase was collected, and the organic phase was washed with saturated saline. 5. The organic phase was dried using anhydrous sodium sulfate. 6. The solvent was removed by pressurized distillation to give the target product 3-chloro-2-methoxy-5-nitropyridine (45.8 mg) as colorful oil. 5. the organic phase was dried using anhydrous sodium sulfate. 6. the solvent was removed by pressurized distillation to give the target product 3-chloro-2-methoxy-5-nitropyridine (45.8 mg) in the form of a colorless oil. |  | [References] 
 [1] Patent: EP2589592,  2018,  B1. Location in patent: Paragraph 1105; 1106
 | 
 | 
                    
                        
                            | Company Name: | CHATURYA BIOTECH |  
                            | Tel: | +91-7702707258 |  
                            | Website: | www.chaturyabiotech.com |  
                    
                        
                            | Company Name: | Cool Pharm, Ltd |  
                            | Tel: | 021-60455363 18019463053 |  
                            | Website: | www.coolpharm.com |  |