| Identification | Back Directory | [Name]
2,2'-DIIODOBIPHENYL | [CAS]
2236-52-4 | [Synonyms]
SKL011 2,2'-DIIODOBIPHENYL 2,2'-Diiodobiphenyl> 2,2'-Diiodo-1,1'-biphenyl 1,1'-Biphenyl, 2,2'-diiodo- 1-iodo-2-(2-iodophenyl)benzene 2,2'-DIIODOBIPHENYL ISO 9001:2015 REACH | [Molecular Formula]
C12H8I2 | [MDL Number]
MFCD00017622 | [MOL File]
2236-52-4.mol | [Molecular Weight]
406 |
| Chemical Properties | Back Directory | [Melting point ]
210-211℃ | [Boiling point ]
130-150 °C(Press: 0.7 Torr) | [density ]
2.041±0.06 g/cm3(Predicted) | [form ]
powder to crystal | [color ]
White to Almost white | [InChI]
InChI=1S/C12H8I2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H | [InChIKey]
OZVRXSGTNWILMN-UHFFFAOYSA-N | [SMILES]
C1(C2=CC=CC=C2I)=CC=CC=C1I |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Maya High Purity Chemicals
|
| Tel: |
+86 (573) 82222445 (0)18006601000 452520369 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15221/0_EN.htm |
|