| Identification | Back Directory | [Name]
4-AZATRICYCLO[4.3.1.1(3,8)]UNDECAN-5-ONE | [CAS]
22607-75-6 | [Synonyms]
NSC 145164 AKOS BC-0498 4-AZAHOMOADAMANTAN-5-ONE 5-Azatricyclo[4.3.1.13,8]undecane-4-one 4-AZATRICYCLO[4.3.1.1(3,8)]UNDECAN-5-ONE 4-Azaazatricyclo[4.3.1.13,8]undecan-5-one 4-azatricyclo(4.3.1.1(sup3,8))undecan-5-one | [Molecular Formula]
C10H15NO | [MDL Number]
MFCD00154765 | [MOL File]
22607-75-6.mol | [Molecular Weight]
165.23 |
| Chemical Properties | Back Directory | [Melting point ]
316-318 °C(lit.)
| [Boiling point ]
344.0±11.0 °C(Predicted) | [density ]
1.103±0.06 g/cm3 (20 ºC 760 Torr) | [solubility ]
chloroform: soluble2.5%, clear, colorless | [pka]
15.95±0.20(Predicted) | [InChI]
1S/C10H15NO/c12-10-8-2-6-1-7(3-8)5-9(4-6)11-10/h6-9H,1-5H2,(H,11,12)/t6-,7+,8-,9+ | [InChIKey]
OKDJIRNQPPBDKJ-SPJNRGJMSA-N | [SMILES]
O=C1N[C@H]2C[C@@H]3C[C@H](C2)C[C@H]1C3 | [CAS DataBase Reference]
22607-75-6 |
| Hazard Information | Back Directory | [Uses]
4-Azatricyclo[4.3.1.1]undecan-5-one is formed during the Beckman rearrangement of adamantanone oxime. Crystal structure of 4-azatricyclo[4.3.1.1]undecan-5-one (homoazaadamantanone) has been studied. | [General Description]
4-Azatricyclo[4.3.1.1]undecan-5-one is formed during the Beckman rearrangement of adamantanone oxime. Crystal structure of 4-azatricyclo[4.3.1.1]undecan-5-one (homoazaadamantanone) has been studied. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|