| Identification | Back Directory | [Name]
BIS(4-FLUOROPHENYL)CHLOROPHOSPHINE | [CAS]
23039-97-6 | [Synonyms]
BIS(4-FLUOROPHENYL)CHLOROPHOSPHINE Chlorobis(4-fluorophenyl)phosphine, 98% Chlorobis(4-fluorophenyl)phosphine, 98+% BIS(4-FLUOROPHENYL)CHLOROPHOSPHINE,MIN.98% Bis(4-fluorophenyl) chlorophosphine, Min. 98% Phosphinous chloride, P,P-bis(4-fluorophenyl)- | [Molecular Formula]
C12H8ClF2P | [MDL Number]
MFCD04972302 | [MOL File]
23039-97-6.mol | [Molecular Weight]
256.62 |
| Chemical Properties | Back Directory | [Boiling point ]
110 °C(Press: 1 Torr) | [storage temp. ]
2-8°C, protect from light, stored under nitrogen | [form ]
liquid | [color ]
pale yellow | [Water Solubility ]
Reacts with water. | [Sensitive ]
Moisture Sensitive | [InChI]
1S/C12H8ClF2P/c13-16(11-5-1-9(14)2-6-11)12-7-3-10(15)4-8-12/h1-8H | [InChIKey]
PYFWYPBHSZATST-UHFFFAOYSA-N | [SMILES]
Fc1ccc(cc1)P(Cl)c2ccc(cc2)F |
| Hazard Information | Back Directory | [Uses]
In chemical research. Used as an interphasic transfer catalyst, a polymerization catalyst, and a trans-halogenation catalyst. As a precursor to fire-retardant materials. |
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Alfa Aesar
|
| Tel: |
1 800 209 7001 |
| Website: |
www.thermofisher.in |
|