| Identification | Back Directory | [Name]
N-Nitroso paroxetine ImpurityQ: What is
N-Nitroso paroxetine Impurity Q: What is the CAS Number of
N-Nitroso paroxetine Impurity | [CAS]
2361294-43-9 | [Synonyms]
N-Nitroso paroxetine ImpurityQ: What is
N-Nitroso paroxetine Impurity Q: What is the CAS Number of
N-Nitroso paroxetine Impurity | [Molecular Formula]
C19H19FN2O4 | [MOL File]
2361294-43-9.mol | [Molecular Weight]
358.37 |
| Chemical Properties | Back Directory | [Boiling point ]
525.0±50.0 °C(Predicted) | [density ]
1.38±0.1 g/cm3(Predicted) | [solubility ]
Chloroform (Slightly), DMSO (Slightly) | [form ]
Solid | [pka]
-4.10±0.60(Predicted) | [color ]
White to Pale Yellow | [InChI]
InChI=1/C19H19FN2O4/c20-15-3-1-13(2-4-15)17-7-8-22(21-23)10-14(17)11-24-16-5-6-18-19(9-16)26-12-25-18/h1-6,9,14,17H,7-8,10-12H2/t14-,17-/s3 | [InChIKey]
PGGPFZLMRYLTFT-OALMKZFLNA-N | [SMILES]
C([C@@H]1CN(N=O)CC[C@H]1C1C=CC(F)=CC=1)OC1=CC=C2OCOC2=C1 |&1:1,8,r| |
| Hazard Information | Back Directory | [Uses]
N-Nitroso Paroxetine is an impurity of Paroxetine (N791895). N-Nitroso Paroxetine is a selective serotonin reuptake inhibitor. Used as an antidepressant. |
|
|