| Identification | Back Directory | [Name]
methyl (±)-2-(2,4-dichlorophenoxy)propionate | [CAS]
23844-57-7 | [Synonyms]
Einecs 245-907-4
Methyl (1)-2-(2,4-dichlorophenoxy)propionate
rac-(S*)-2-(2,4-Dichlorophenoxy)propanoic acid methyl ester
rac-(2R*)-2-(2,4-Dichlorophenoxy)propionic acid methyl ester | [EINECS(EC#)]
245-907-4 | [Molecular Formula]
C10H10Cl2O3 | [MOL File]
23844-57-7.mol | [Molecular Weight]
249.09 |
| Chemical Properties | Back Directory | [Boiling point ]
111 °C(Press: 0.8 Torr) | [density ]
1.306±0.06 g/cm3(Predicted) | [Major Application]
agriculture
environmental | [InChI]
1S/C10H10Cl2O3/c1-6(10(13)14-2)15-9-4-3-7(11)5-8(9)12/h3-6H,1-2H3 | [InChIKey]
SCHCPDWDIOTCMJ-UHFFFAOYSA-N | [SMILES]
COC(=O)C(C)Oc1ccc(Cl)cc1Cl |
| Hazard Information | Back Directory | [Uses]
Refer to the productμs Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. | [Production Methods]
The industrial manufacture of dichlorprop-methyl follows the same pattern used for other phenoxy-propionate herbicide esters: first produce purified dichlorprop acid, then convert it into the desired ester under controlled conditions. Upstream, manufacturers generate dichlorprop acid by chlorinating and alkylating the phenoxypropionate framework, followed by resolution or controlled synthesis to achieve the required isomer ratio and then purifying the acid to technical grade. To create the methyl ester, the acid is reacted with methanol under controlled esterification conditions, typically in the presence of an acid catalyst and with continuous removal of the water formed during the reaction to push the equilibrium toward full conversion while limiting side reactions. | [Mechanism of action]
Selective, systemic, absorbed through leaves and translocates to roots. Synthetic auxin causing stem and leaf malformations leading to death. | [Pesticide Type]
Herbicide |
|
|