| Identification | Back Directory | [Name]
3-(2-(pyridin-3-yl)disulfanyl)pyridine | [CAS]
24367-50-8 | [Synonyms]
TAK438 Impurity 119 Vonoprazan Impurity 123 Pyridine, 3,3'-dithiobis- 1,2-Di(pyridin-3-yl)disulfane 3-(PYRIDIN-3-YLDISULFANYL)PYRIDINE 3-(2-(pyridin-3-yl)disulfanyl)pyridine 3-(2-(pyridine-3-yl)disulfanyl)pyridine | [Molecular Formula]
C10H8N2S2 | [MDL Number]
MFCD17171436 | [MOL File]
24367-50-8.mol | [Molecular Weight]
220.31 |
| Chemical Properties | Back Directory | [Boiling point ]
180-183 °C(Press: 4 Torr) | [density ]
1.34±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C | [pka]
3.44±0.11(Predicted) | [InChI]
InChI=1S/C10H8N2S2/c1-3-9(7-11-5-1)13-14-10-4-2-6-12-8-10/h1-8H | [InChIKey]
YURPISYZTZHYBW-UHFFFAOYSA-N | [SMILES]
S(C1=CC=CN=C1)SC1=CC=CN=C1 |
| Hazard Information | Back Directory | [Uses]
1,2-Di(pyridin-3-yl)disulfane is a useful research chemical used in the synthesis of disulfides and diselenides by copper-catalyzed coupling reactions of aryl halides and sulfur or selenium in water. |
|
| Company Name: |
TOSUN PHARM
|
| Tel: |
020-66392521-118 18922260391 |
| Website: |
www.toref.cn/ |
|