| Identification | Back Directory | [Name]
2,7-DINITRONAPHTHALENE | [CAS]
24824-27-9 | [Synonyms]
Einecs 246-480-7
2,7-dinitro-naphthalen
2,7-DINITRONAPHTHALENE
Naphthalene, 2,7-dinitro-
2,7-Dinitronaphthalene >=95.0% (HPLC) | [EINECS(EC#)]
246-480-7 | [Molecular Formula]
C10H6N2O4 | [MDL Number]
MFCD00042707 | [MOL File]
24824-27-9.mol | [Molecular Weight]
218.17 |
| Chemical Properties | Back Directory | [Melting point ]
229-233 °C | [Boiling point ]
413.5±18.0 °C(Predicted) | [density ]
1.481±0.06 g/cm3(Predicted) | [BRN ]
2214687 | [InChI]
1S/C10H6N2O4/c13-11(14)9-3-1-7-2-4-10(12(15)16)6-8(7)5-9/h1-6H | [InChIKey]
AFDWAIQLYHEUIW-UHFFFAOYSA-N | [SMILES]
[O-][N+](=O)c1ccc2ccc(cc2c1)[N+]([O-])=O |
| Safety Data | Back Directory | [Risk Statements ]
52/53 | [Safety Statements ]
61 | [RIDADR ]
2811 | [WGK Germany ]
3 | [RTECS ]
QJ4552500 | [HazardClass ]
6.1(b) | [PackingGroup ]
III | [Storage Class]
13 - Non Combustible Solids |
| Hazard Information | Back Directory | [Uses]
2,7-Dinitronaphthalene has been used for the cyclodextrin distribution capillary electrochromatographic separation of naphthalene compounds. | [Definition]
ChEBI: 2,7-dinitronaphthalene is a dinitronaphthalene. | [General Description]
Kinetics and ESR studies of intramolecular electron-transfer reactions of the radical anion of 2,7-dinitronaphthalene in various polar aprotic solvents has been studied. 2,7-Dinitronaphthalene undergoes mononitration to afford 1:3:6:8-tetranitronapthalene. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
A.J Chemicals
|
| Tel: |
91-9810153283 |
| Website: |
www.ajchemicals.com |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
| Company Name: |
Interchim S.A.
|
| Tel: |
(33) 4 70 03 88 55 |
| Website: |
www.interchim.com |
|