| Identification | Back Directory | [Name]
Phosphine, dicyclohexyl[3-(1,1-dimethylethoxy)-6-methoxy-2',6'-bis(1-methylethyl)[1,1'-biphenyl]-2-yl]- | [CAS]
2489243-29-8 | [Synonyms]
3-(tert-Butoxy)-2’,6’-diisopropyl-6-methoxy-2-biphenylyl]dicyclohexylphosphine (3-(tert-Butoxy)-2',6'-diisopropyl-6-methoxy-[1,1'-biphenyl]-2-yl)dicyclohexylphosphane Phosphine, dicyclohexyl[3-(1,1-dimethylethoxy)-6-methoxy-2',6'-bis(1-methylethyl)[1,1'-biphenyl]-2-yl]- | [Molecular Formula]
C35H53O2P | [MOL File]
2489243-29-8.mol | [Molecular Weight]
536.77 |
| Chemical Properties | Back Directory | [Melting point ]
230-233°C | [Boiling point ]
617.9±55.0 °C(Predicted) | [storage temp. ]
RT, stored under nitrogen | [form ]
solid | [Appearance]
White to off-white Solid | [InChIKey]
JKLUIDIKASJZCK-UHFFFAOYSA-N | [SMILES]
P(C1CCCCC1)(C1CCCCC1)C1=C(OC(C)(C)C)C=CC(OC)=C1C1=C(C(C)C)C=CC=C1C(C)C |
| Hazard Information | Back Directory | [Uses]
(3-(tert-Butoxy)-2',6'-diisopropyl-6-methoxy-[1,1'-biphenyl]-2-yl)dicyclohexylphosphane can be used in carbon-carbon bond formation-Cross coupling reaction.
| [reaction suitability]
reaction type: Cross Couplings reagent type: catalyst reagent type: ligand |
|
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Tel: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
| Company Name: |
Hongdebiotech
|
| Tel: |
17712623939 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList1520360/0_EN.htm |
|