| Identification | Back Directory | [Name]
4'-NITRO-4-DIMETHYLAMINOAZOBENZENE | [CAS]
2491-74-9 | [Synonyms]
Orange 1D Nitrodimethylaminoazobenzene 4-DIMETHYLAMINO-4'-NITROAZOBENZENE 4'-NITRO-4-DIMETHYLAMINOAZOBENZENE 4''-NITRO-4-DIMETHYLAMINOAZOBENZENE 98+% N,N-Dimethyl-p-[(p-nitrophenyl)azo]aniline dimethyl-[4-(4-nitrophenyl)azophenyl]amine N,N-dimethyl-4-(4-nitrophenyl)diazenylaniline N,N-dimethyl-4-(4-nitrophenyl)diazenyl-aniline n,n-dimethyl-4-[(4-nitrophenyl)azo]-benzenamin N,N-Dimethyl-4-[(4-nitrophenyl)azo]benzenamine Benzenamine, N,N-dimethyl-4-[(4-nitrophenyl)azo]- N,N-Dimethyl-4-[(E)-(4-nitrophenyl)diazenyl]aniline | [Molecular Formula]
C14H14N4O2 | [MDL Number]
MFCD00059834 | [MOL File]
2491-74-9.mol | [Molecular Weight]
270.29 |
| Chemical Properties | Back Directory | [Melting point ]
229°C | [Boiling point ]
413.4°C (rough estimate) | [density ]
1.1764 (rough estimate) | [refractive index ]
1.6000 (estimate) | [form ]
powder to crystal | [color ]
Orange to Brown to Dark purple | [Water Solubility ]
0.5406ug/L(25 ºC) | [InChI]
InChI=1S/C14H14N4O2/c1-17(2)13-7-3-11(4-8-13)15-16-12-5-9-14(10-6-12)18(19)20/h3-10H,1-2H3 | [InChIKey]
LSFRFLVWCKLQTO-UHFFFAOYSA-N | [SMILES]
C1(N(C)C)=CC=C(N=NC2=CC=C([N+]([O-])=O)C=C2)C=C1 | [EPA Substance Registry System]
Benzenamine, N,N-dimethyl-4-[(4-nitrophenyl)azo]- (2491-74-9) |
|
| Company Name: |
Maya High Purity Chemicals
|
| Tel: |
+86 (573) 82222445 (0)18006601000 452520369 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15221/0_EN.htm |
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
|