| Identification | Back Directory | [Name]
4-(4-BUTYLPHENYLAZO)PHENOL | [CAS]
2496-21-1 | [Synonyms]
4-(4-BUTYLPHENYLAZO)PHENOL 4-BUTYL-4'-HYDROXYAZOBENZENE 4-(4-BUTYLPHENYLAZO)PHENOL EP 4-(4-Butylphenylazo)phenol > 4-[2-(4-butylphenyl)diazenyl]-phenol Phenol, 4-[2-(4-butylphenyl)diazenyl]- 4-[(4-butylphenyl)hydrazinylidene]cyclohexa-2,5-dien-1-one | [Molecular Formula]
C16H18N2O | [MDL Number]
MFCD00430795 | [MOL File]
2496-21-1.mol | [Molecular Weight]
254.33 |
| Chemical Properties | Back Directory | [Melting point ]
80 °C | [Boiling point ]
424.5±38.0 °C(Predicted) | [density ]
1.06±0.1 g/cm3(Predicted) | [solubility ]
soluble in Acetone | [form ]
powder to crystal | [pka]
8.92±0.15(Predicted) | [color ]
Light yellow to Amber to Dark green | [InChI]
InChI=1S/C16H18N2O/c1-2-3-4-13-5-7-14(8-6-13)17-18-15-9-11-16(19)12-10-15/h5-12,19H,2-4H2,1H3 | [InChIKey]
FIWNTOUHYJJODB-UHFFFAOYSA-N | [SMILES]
C1(O)=CC=C(N=NC2=CC=C(CCCC)C=C2)C=C1 |
| Hazard Information | Back Directory | [Uses]
4-(4-Butylphenylazo)phenol interacts with certain biomolecules, allowing the binding and transport of these molecules in biological systems to be studied. Its unique chemical structure makes it a useful probe for studying the structure and function of biological macromolecules. |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
|