| Identification | Back Directory | [Name]
1,2-didecanoyl-sn-glycero-3-phosphoethanolaMine | [CAS]
253685-27-7 | [Synonyms]
1,2-didecanoyl-sn-glycero-3-phosphoethanolaMine 1,2-DIDECANOYL-SN-GLYCERO-3-PHOSPHOETHANOLAMINE;10:0 PE (2R)-3-(((2-Aminoethoxy)(hydroxy)phosphoryl)oxy)propane-1,2-diyl bis(decanoate) Decanoic acid, 1,1'-[(1R)-1-[[[(2-aminoethoxy)hydroxyphosphinyl]oxy]methyl]-1,2-ethanediyl] ester | [Molecular Formula]
C25H50NO8P | [MDL Number]
MFCD02259265 | [MOL File]
253685-27-7.mol | [Molecular Weight]
523.64 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [form ]
powder | [InChIKey]
KKOSJVWUOHEQKA-HSZRJFAPSA-N | [SMILES]
[H][C@@](COP([O-])(OCC[NH3+])=O)(OC(CCCCCCCCC)=O)COC(CCCCCCCCC)=O |
| Hazard Information | Back Directory | [Uses]
Glycerophospholipids act as regulators of various enzyme activities, and can be used as biological markers to indicate pathological states. | [Definition]
ChEBI: PE(10:0/10:0) is a phosphatidylethanolamine 20:0. | [Biological Activity]
Phosphatidylethanolamine forms pure lipid structures. It maintains membrane fluidity in eukaryotic cells. Phosphatidylethanolamine plays a critical role in autophagycell division and protein folding. It acts as a precursor for the synthesis of various protein modifications. Phosphatidylethanolamine functions as an intermediate for the synthesis of glycerophospholipid classes. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|