| Identification | Back Directory | [Name]
2,9-Diphenyl-1,10-phenanthroline | [CAS]
25677-69-4 | [Synonyms]
2,9-Diphenyl-1,10-phenanthroline 1,10-Phenanthroline, 2,9-diphenyl- 2,9-Diphenyl-1,10-phenanthroline> | [Molecular Formula]
C24H16N2 | [MDL Number]
MFCD00044208 | [MOL File]
25677-69-4.mol | [Molecular Weight]
332.397 |
| Chemical Properties | Back Directory | [Melting point ]
186.0 to 190.0 °C | [Boiling point ]
559.5±45.0 °C(Predicted) | [density ]
1.210±0.06 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,Room Temperature | [form ]
powder to crystal | [pka]
4.82±0.30(Predicted) | [color ]
White to Yellow | [InChI]
InChI=1S/C24H16N2/c1-3-7-17(8-4-1)21-15-13-19-11-12-20-14-16-22(18-9-5-2-6-10-18)26-24(20)23(19)25-21/h1-16H | [InChIKey]
HVCVRVKEIKXBIF-UHFFFAOYSA-N | [SMILES]
N1C2C(=CC=C3C=2N=C(C2=CC=CC=C2)C=C3)C=CC=1C1=CC=CC=C1 | [CAS DataBase Reference]
25677-69-4 |
|
| Company Name: |
Shanghai UCHEM Inc. Gold
|
| Tel: |
18939844854 |
| Website: |
www.chemicalbook.com/supplier/23967788/ |
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
|