| Identification | Back Directory | [Name]
5-METHYL-2-PHENYL-PYRIDINE | [CAS]
27012-22-2 | [Synonyms]
Einecs 248-163-9 6-Phenyl-3-picoline 2-PHENYL-5-METHYLPYRIDINE 5-METHYL-2-PHENYL-PYRIDINE Pyridine, 5-methyl-2-phenyl- | [EINECS(EC#)]
248-163-9 | [Molecular Formula]
C12H11N | [MDL Number]
MFCD04114180 | [MOL File]
27012-22-2.mol | [Molecular Weight]
169.22 |
| Chemical Properties | Back Directory | [Melting point ]
53.0 to 57.0 °C | [Boiling point ]
166°C/16mmHg(lit.) | [density ]
1.030±0.06 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,Room Temperature | [form ]
powder to crystal | [pka]
4.73±0.10(Predicted) | [color ]
White to Orange to Green | [λmax]
275nm(EtOH)(lit.) | [InChI]
InChI=1S/C12H11N/c1-10-7-8-12(13-9-10)11-5-3-2-4-6-11/h2-9H,1H3 | [InChIKey]
ZYLPQYYLLRBVOK-UHFFFAOYSA-N | [SMILES]
C1(C2=CC=CC=C2)=NC=C(C)C=C1 |
|
| Company Name: |
SynAsst Chemical.
|
| Telephone: |
021-60343070 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15848/0_EN.htm |
| Company Name: |
parabiochem
|
| Telephone: |
025-83453382-8005 |
| Website: |
www.parabiochem.cn |
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Telephone: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
|